CAS 250375-08-7 appears in our catalog under these names: Boc-(Me)Thr(Bzl)-OH Cha, 97%, BOc-methr(bzl)-oh cha, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 100g, 5g.
Cyclohexanamine;(2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid (CAS 250375-08-7) is a chemical compound with the molecular formula C23H38N2O5 and a molecular weight of 422.6 g/mol. IUPAC name: cyclohexanamine;(2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid. InChIKey: CULYTHDISPZXCH-OJMBIDBESA-N.
| Molecular formula | C23H38N2O5 |
|---|---|
| Molecular weight | 422.6 g/mol |
| IUPAC name | cyclohexanamine;(2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid |
| InChIKey | CULYTHDISPZXCH-OJMBIDBESA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C)OCC1=CC=CC=C1.C1CCC(CC1)N |
Computed by PubChem (NCBI)