Products 2504147-25-3
CAS 2504147-25-3 is the registry number for S 3-(4-Bromo-phenyl)-2-isobutyrylamino-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2S)-3-(4-bromophenyl)-2-(2-methylpropanoylamino)propanoate (CAS 2504147-25-3) is a chemical compound with the molecular formula C14H18BrNO3 and a molecular weight of 328.20 g/mol. IUPAC name: methyl (2S)-3-(4-bromophenyl)-2-(2-methylpropanoylamino)propanoate. InChIKey: DIHDBOQWUMXZKD-LBPRGKRZSA-N.
| Molecular formula | C14H18BrNO3 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | methyl (2S)-3-(4-bromophenyl)-2-(2-methylpropanoylamino)propanoate |
| InChIKey | DIHDBOQWUMXZKD-LBPRGKRZSA-N |
| SMILES | CC(C)C(=O)N[C@@H](CC1=CC=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)