CAS 2504201-50-5 is the registry number for (2,2-Difluoro-benzo[1,3]dioxol-5-yl)-phenyl-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2,2-difluoro-1,3-benzodioxol-5-yl)-phenylmethanone (CAS 2504201-50-5) is a chemical compound with the molecular formula C14H8F2O3 and a molecular weight of 262.21 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)-phenylmethanone. InChIKey: QGAMYJVORIKPRL-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O3 |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)-phenylmethanone |
| InChIKey | QGAMYJVORIKPRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)