CAS 2504201-83-4 is the registry number for 3-Bromo-6-chloro-n-cyclopropyl-2-fluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-6-chloro-N-cyclopropyl-2-fluorobenzamide (CAS 2504201-83-4) is a chemical compound with the molecular formula C10H8BrClFNO and a molecular weight of 292.53 g/mol. IUPAC name: 3-bromo-6-chloro-N-cyclopropyl-2-fluorobenzamide. InChIKey: LAVKXQDTXURLIE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClFNO |
|---|---|
| Molecular weight | 292.53 g/mol |
| IUPAC name | 3-bromo-6-chloro-N-cyclopropyl-2-fluorobenzamide |
| InChIKey | LAVKXQDTXURLIE-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=C(C=CC(=C2F)Br)Cl |
Computed by PubChem (NCBI)