Products 2504201-97-0

CAS 2504201-97-0 is the registry number for Methylamino-peg2-acid hydrochloride salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-[2-[2-(methylamino)ethoxy]ethoxy]propanoic acid;hydrochloride (CAS 2504201-97-0) is a chemical compound with the molecular formula C8H18ClNO4 and a molecular weight of 227.68 g/mol. IUPAC name: 3-[2-[2-(methylamino)ethoxy]ethoxy]propanoic acid;hydrochloride. InChIKey: AFBCJFFZGHLWRU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO4
Molecular weight227.68 g/mol
IUPAC name3-[2-[2-(methylamino)ethoxy]ethoxy]propanoic acid;hydrochloride
InChIKeyAFBCJFFZGHLWRU-UHFFFAOYSA-N
SMILESCNCCOCCOCCC(=O)O.Cl

Computed by PubChem (NCBI)