Products 2504202-19-9

CAS 2504202-19-9 is the registry number for 3-Bromo-6-chloro-n-cyclohexyl-2-fluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-6-chloro-N-cyclohexyl-2-fluorobenzamide (CAS 2504202-19-9) is a chemical compound with the molecular formula C13H14BrClFNO and a molecular weight of 334.61 g/mol. IUPAC name: 3-bromo-6-chloro-N-cyclohexyl-2-fluorobenzamide. InChIKey: YUYCPEVABGKZND-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BrClFNO
Molecular weight334.61 g/mol
IUPAC name3-bromo-6-chloro-N-cyclohexyl-2-fluorobenzamide
InChIKeyYUYCPEVABGKZND-UHFFFAOYSA-N
SMILESC1CCC(CC1)NC(=O)C2=C(C=CC(=C2F)Br)Cl

Computed by PubChem (NCBI)