Products 2504202-67-7
CAS 2504202-67-7 is the registry number for tert-Butyl 4-bromo-2-isopropoxybenzylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl N-[(4-bromo-2-propan-2-yloxyphenyl)methyl]carbamate (CAS 2504202-67-7) is a chemical compound with the molecular formula C15H22BrNO3 and a molecular weight of 344.24 g/mol. IUPAC name: tert-butyl N-[(4-bromo-2-propan-2-yloxyphenyl)methyl]carbamate. InChIKey: RXHHACGSZHAYSE-UHFFFAOYSA-N.
| Molecular formula | C15H22BrNO3 |
|---|---|
| Molecular weight | 344.24 g/mol |
| IUPAC name | tert-butyl N-[(4-bromo-2-propan-2-yloxyphenyl)methyl]carbamate |
| InChIKey | RXHHACGSZHAYSE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)Br)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)