CAS 2504202-69-9 is the registry number for 2-Bromo-4-isobutoxy-1-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-bromo-4-(2-methylpropoxy)-1-(trifluoromethyl)benzene (CAS 2504202-69-9) is a chemical compound with the molecular formula C11H12BrF3O and a molecular weight of 297.11 g/mol. IUPAC name: 2-bromo-4-(2-methylpropoxy)-1-(trifluoromethyl)benzene. InChIKey: LQXUWZVXVBDUKB-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF3O |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | 2-bromo-4-(2-methylpropoxy)-1-(trifluoromethyl)benzene |
| InChIKey | LQXUWZVXVBDUKB-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC(=C(C=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)