Products 2504202-79-1
CAS 2504202-79-1 is the registry number for Benzyl 2-fluoro-4-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl 2-fluoro-4-(trifluoromethyl)benzoate (CAS 2504202-79-1) is a chemical compound with the molecular formula C15H10F4O2 and a molecular weight of 298.23 g/mol. IUPAC name: benzyl 2-fluoro-4-(trifluoromethyl)benzoate. InChIKey: PUDIYFRPXNAZRK-UHFFFAOYSA-N.
| Molecular formula | C15H10F4O2 |
|---|---|
| Molecular weight | 298.23 g/mol |
| IUPAC name | benzyl 2-fluoro-4-(trifluoromethyl)benzoate |
| InChIKey | PUDIYFRPXNAZRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C=C(C=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)