CAS 2504203-06-7 is the registry number for 5-(6-Oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonyl chloride hydrochloride, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonyl chloride;hydrochloride (CAS 2504203-06-7) is a chemical compound with the molecular formula C8H6Cl2N2O3S2 and a molecular weight of 313.2 g/mol. IUPAC name: 5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonyl chloride;hydrochloride. InChIKey: DMPQUDHDAPIDDB-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O3S2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonyl chloride;hydrochloride |
| InChIKey | DMPQUDHDAPIDDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NN=C1C2=CC=C(S2)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)