CAS 2504203-29-4 is the registry number for Sodium 4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-ide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione (CAS 2504203-29-4) is a chemical compound with the molecular formula C19H19N2NaO2 and a molecular weight of 330.4 g/mol. IUPAC name: sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione. InChIKey: VYOUHDLOIRJOSW-UHFFFAOYSA-N.
| Molecular formula | C19H19N2NaO2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione |
| InChIKey | VYOUHDLOIRJOSW-UHFFFAOYSA-N |
| SMILES | CCCC[C-]1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3.[Na+] |
Computed by PubChem (NCBI)