CAS 2504203-51-2 is the registry number for tert-Butyl (3-fluoro-2-nitrophenyl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-(3-fluoro-2-nitrophenyl)carbamate (CAS 2504203-51-2) is a chemical compound with the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. IUPAC name: tert-butyl N-(3-fluoro-2-nitrophenyl)carbamate. InChIKey: BQUSPXOGHOFBSJ-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O4 |
|---|---|
| Molecular weight | 256.23 g/mol |
| IUPAC name | tert-butyl N-(3-fluoro-2-nitrophenyl)carbamate |
| InChIKey | BQUSPXOGHOFBSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)