CAS 2504203-60-3 is the registry number for 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethanamine;hydrochloride (CAS 2504203-60-3) is a chemical compound with the molecular formula C10H12ClF4NO and a molecular weight of 273.65 g/mol. IUPAC name: 1-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethanamine;hydrochloride. InChIKey: WQTFKLJHPDCVPI-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF4NO |
|---|---|
| Molecular weight | 273.65 g/mol |
| IUPAC name | 1-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | WQTFKLJHPDCVPI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OCC(F)(F)F)F)N.Cl |
Computed by PubChem (NCBI)