Products 2504203-81-8
CAS 2504203-81-8 is the registry number for 3-(6-Bromo-naphthalen-2-yloxy)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 3-(6-bromonaphthalen-2-yl)oxyazetidine-1-carboxylate (CAS 2504203-81-8) is a chemical compound with the molecular formula C18H20BrNO3 and a molecular weight of 378.3 g/mol. IUPAC name: tert-butyl 3-(6-bromonaphthalen-2-yl)oxyazetidine-1-carboxylate. InChIKey: ADBCAONZBSLHTO-UHFFFAOYSA-N.
| Molecular formula | C18H20BrNO3 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | tert-butyl 3-(6-bromonaphthalen-2-yl)oxyazetidine-1-carboxylate |
| InChIKey | ADBCAONZBSLHTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=CC3=C(C=C2)C=C(C=C3)Br |
Computed by PubChem (NCBI)