CAS 2504203-91-0 is the registry number for (3-Bromo-6-chloro-2-fluorophenyl)(piperidin-1-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(3-bromo-6-chloro-2-fluorophenyl)-piperidin-1-ylmethanone (CAS 2504203-91-0) is a chemical compound with the molecular formula C12H12BrClFNO and a molecular weight of 320.58 g/mol. IUPAC name: (3-bromo-6-chloro-2-fluorophenyl)-piperidin-1-ylmethanone. InChIKey: HPUUUGSMNNSTQT-UHFFFAOYSA-N.
| Molecular formula | C12H12BrClFNO |
|---|---|
| Molecular weight | 320.58 g/mol |
| IUPAC name | (3-bromo-6-chloro-2-fluorophenyl)-piperidin-1-ylmethanone |
| InChIKey | HPUUUGSMNNSTQT-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C=CC(=C2F)Br)Cl |
Computed by PubChem (NCBI)