CAS 2504210-32-4 is the registry number for Tofacitinib Impurity 173. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-1-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N,4-dimethylpiperidin-3-amine (CAS 2504210-32-4) is a chemical compound with the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. IUPAC name: (3R,4R)-1-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N,4-dimethylpiperidin-3-amine. InChIKey: SFJWJKDDYBNESX-SCZZXKLOSA-N.
| Molecular formula | C13H18ClN5 |
|---|---|
| Molecular weight | 279.77 g/mol |
| IUPAC name | (3R,4R)-1-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N,4-dimethylpiperidin-3-amine |
| InChIKey | SFJWJKDDYBNESX-SCZZXKLOSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)C2=NC(=NC3=C2C=CN3)Cl |
Computed by PubChem (NCBI)