CAS 2504234-80-2 is the registry number for Methyl 1-(2,6-dioxopiperidin-3-yl)-2-oxo-1,2-dihydrobenzo[cd]indole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carboxylate (CAS 2504234-80-2) is a chemical compound with the molecular formula C18H14N2O5 and a molecular weight of 338.3 g/mol. IUPAC name: methyl 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carboxylate. InChIKey: GYONKZPLCUNDMQ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O5 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | methyl 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carboxylate |
| InChIKey | GYONKZPLCUNDMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC=C3C2=C(C=C1)N(C3=O)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)