Products 950362-44-4
CAS 950362-44-4 is the registry number for 1-(2-((4-Carboxyphenyl)amino)-2-oxoethyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(4-carboxyanilino)-2-oxoethyl]indole-2-carboxylic acid (CAS 950362-44-4) is a chemical compound with the molecular formula C18H14N2O5 and a molecular weight of 338.3 g/mol. IUPAC name: 1-[2-(4-carboxyanilino)-2-oxoethyl]indole-2-carboxylic acid. InChIKey: OGOGVNSXYUMOIL-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O5 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 1-[2-(4-carboxyanilino)-2-oxoethyl]indole-2-carboxylic acid |
| InChIKey | OGOGVNSXYUMOIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2CC(=O)NC3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)