CAS 25044-96-6 is the registry number for cis-Dibromobis(triphenylphosphine)palladium, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibromopalladium;bis(triphenylphosphane) (CAS 25044-96-6) is a chemical compound with the molecular formula C36H30Br2P2Pd and a molecular weight of 790.8 g/mol. IUPAC name: dibromopalladium;bis(triphenylphosphane). InChIKey: MCSDDEAMPOYJJI-UHFFFAOYSA-L.
| Molecular formula | C36H30Br2P2Pd |
|---|---|
| Molecular weight | 790.8 g/mol |
| IUPAC name | dibromopalladium;bis(triphenylphosphane) |
| InChIKey | MCSDDEAMPOYJJI-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Br[Pd]Br |
Computed by PubChem (NCBI)