Products 2504954-38-3

CAS 2504954-38-3 is the registry number for 4-Ethynyl-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-ethynyl-3-(trifluoromethyl)benzoic acid (CAS 2504954-38-3) is a chemical compound with the molecular formula C10H5F3O2 and a molecular weight of 214.14 g/mol. IUPAC name: 4-ethynyl-3-(trifluoromethyl)benzoic acid. InChIKey: ULRHTECEKJLYJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5F3O2
Molecular weight214.14 g/mol
IUPAC name4-ethynyl-3-(trifluoromethyl)benzoic acid
InChIKeyULRHTECEKJLYJJ-UHFFFAOYSA-N
SMILESC#CC1=C(C=C(C=C1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)