CAS 2505-66-0 appears in our catalog under these names: Ezetimibe Impurity 45, (E)-4-((Phenylimino)methyl)phenol, 98%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
4-(phenyliminomethyl)phenol (CAS 2505-66-0) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 4-(phenyliminomethyl)phenol. InChIKey: KAFOXNBOSQXQDL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 4-(phenyliminomethyl)phenol |
| InChIKey | KAFOXNBOSQXQDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)