Products 250599-60-1
CAS 250599-60-1 is the registry number for GW 273629. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-amino-3-[2-(1-aminoethylideneamino)ethylsulfonyl]propanoic acid (CAS 250599-60-1) is a chemical compound with the molecular formula C7H15N3O4S and a molecular weight of 237.28 g/mol. IUPAC name: (2R)-2-amino-3-[2-(1-aminoethylideneamino)ethylsulfonyl]propanoic acid. InChIKey: DDGULJZAQPDKQZ-LURJTMIESA-N.
| Molecular formula | C7H15N3O4S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | (2R)-2-amino-3-[2-(1-aminoethylideneamino)ethylsulfonyl]propanoic acid |
| InChIKey | DDGULJZAQPDKQZ-LURJTMIESA-N |
| SMILES | CC(=NCCS(=O)(=O)C[C@@H](C(=O)O)N)N |
Computed by PubChem (NCBI)