CAS 250609-36-0 appears in our catalog under these names: 4-(2,3-Dimethylnaphtho[2,3-b]thiophen-4-yl)-2,6-dimethylphenol, 97%, 4-(2,3-Dimethylnaphtho[2,3-b]thiophen-4-yl)-2,6-dimethylphenol, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
4-(2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2,6-dimethylphenol (CAS 250609-36-0) is a chemical compound with the molecular formula C22H20OS and a molecular weight of 332.5 g/mol. IUPAC name: 4-(2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2,6-dimethylphenol. InChIKey: IODYQWBSUXFDEJ-UHFFFAOYSA-N.
| Molecular formula | C22H20OS |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | 4-(2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2,6-dimethylphenol |
| InChIKey | IODYQWBSUXFDEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C2=C3C(=C(SC3=CC4=CC=CC=C42)C)C |
Computed by PubChem (NCBI)