CAS 250685-44-0 appears in our catalog under these names: 8-(1-Naphthalenylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro(4.5)decane-3-acetic acid Methyl Ester, NNC 63-0532/ 98.75% (existing batch purity), NNC 63–0532, 8-(1-Naphthalenylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-3-acetic acid Methyl Ester, 97%, 97%, NNC 63-0532, 99.81%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
Methyl 2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate (CAS 250685-44-0) is a chemical compound with the molecular formula C27H29N3O3 and a molecular weight of 443.5 g/mol. IUPAC name: methyl 2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate. InChIKey: AQMPIDSGLFVVPL-UHFFFAOYSA-N.
| Molecular formula | C27H29N3O3 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | methyl 2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
| InChIKey | AQMPIDSGLFVVPL-UHFFFAOYSA-N |
| SMILES | COC(=O)CN1CN(C2(C1=O)CCN(CC2)CC3=CC=CC4=CC=CC=C43)C5=CC=CC=C5 |
Computed by PubChem (NCBI)