Products 250691-57-7
CAS 250691-57-7 is the registry number for Salvisyrianone. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methyl-8-(4-methyl-3-oxopentyl)-3-propan-2-ylnaphthalene-1,2-dione (CAS 250691-57-7) is a chemical compound with the molecular formula C20H24O3 and a molecular weight of 312.4 g/mol. IUPAC name: 7-methyl-8-(4-methyl-3-oxopentyl)-3-propan-2-ylnaphthalene-1,2-dione. InChIKey: KDNPHTQAHFLSCY-UHFFFAOYSA-N.
| Molecular formula | C20H24O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 7-methyl-8-(4-methyl-3-oxopentyl)-3-propan-2-ylnaphthalene-1,2-dione |
| InChIKey | KDNPHTQAHFLSCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=C(C(=O)C2=O)C(C)C)CCC(=O)C(C)C |
Computed by PubChem (NCBI)