CAS 250714-63-7 appears in our catalog under these names: 3-Phenyl-2-([[3-(trifluoromethyl)phenyl]sulfonyl]amino)propanoic acid, 95%, 3-Phenyl-2-({[3-(trifluoromethyl)phenyl]sulfonyl}amino)propanoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (CAS 250714-63-7) is a chemical compound with the molecular formula C16H14F3NO4S and a molecular weight of 373.3 g/mol. IUPAC name: 3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid. InChIKey: JFDJLMGVJXHLOF-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO4S |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
| InChIKey | JFDJLMGVJXHLOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)