Products 2507992-93-8
CAS 2507992-93-8 is the registry number for BTNPO. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 7-(1,3-benzothiazol-2-yl)-1-hydroxy-2-oxo-3H-benzo[e]indole-1-carboxylate (CAS 2507992-93-8) is a chemical compound with the molecular formula C22H16N2O4S and a molecular weight of 404.4 g/mol. IUPAC name: ethyl 7-(1,3-benzothiazol-2-yl)-1-hydroxy-2-oxo-3H-benzo[e]indole-1-carboxylate. InChIKey: ZGEISKDBAVJZNE-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O4S |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | ethyl 7-(1,3-benzothiazol-2-yl)-1-hydroxy-2-oxo-3H-benzo[e]indole-1-carboxylate |
| InChIKey | ZGEISKDBAVJZNE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C2=C(C=CC3=C2C=CC(=C3)C4=NC5=CC=CC=C5S4)NC1=O)O |
Computed by PubChem (NCBI)
Synonyms:
BTNPO, orb1690790