Products 2508-63-6

CAS 2508-63-6 is the registry number for 2-Amino-4-methylpentanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-amino-4-methylpentanoic acid;hydrochloride (CAS 2508-63-6) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: 2-amino-4-methylpentanoic acid;hydrochloride. InChIKey: XKZZNHPZEPVUQK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14ClNO2
Molecular weight167.63 g/mol
IUPAC name2-amino-4-methylpentanoic acid;hydrochloride
InChIKeyXKZZNHPZEPVUQK-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)O)N.Cl

Computed by PubChem (NCBI)