CAS 25080-20-0 is the registry number for 1-(Perfluoroisopropoxy)-1,1,2,2-tetrafluoro-4-iodobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1,1,2,2,4,4,4-heptafluoro-3-(iodomethyl)-1-(1,2,2,2-tetrafluoroethoxy)butane (CAS 25080-20-0) is a chemical compound with the molecular formula C7H4F11IO and a molecular weight of 439.99 g/mol. IUPAC name: 1,1,2,2,4,4,4-heptafluoro-3-(iodomethyl)-1-(1,2,2,2-tetrafluoroethoxy)butane. InChIKey: GXDRJQCAQULYJE-UHFFFAOYSA-N.
| Molecular formula | C7H4F11IO |
|---|---|
| Molecular weight | 439.99 g/mol |
| IUPAC name | 1,1,2,2,4,4,4-heptafluoro-3-(iodomethyl)-1-(1,2,2,2-tetrafluoroethoxy)butane |
| InChIKey | GXDRJQCAQULYJE-UHFFFAOYSA-N |
| SMILES | C(C(C(C(OC(C(F)(F)F)F)(F)F)(F)F)C(F)(F)F)I |
Computed by PubChem (NCBI)