CAS 25084-14-4 appears in our catalog under these names: 5-Nitro-2-furoyl chloride, 95%, 5-Nitrofuran-2-carbonyl chloride, 95-<97%, 5-Nitrofuran-2-carbonyl chloride, ≥97-<99%, 5-Nitrofuran-2-carbonyl chloride, 97%, 5–Nitro–2–furoyl chloride. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 50g, 100g, 200g.
5-nitrofuran-2-carbonyl chloride (CAS 25084-14-4) is a chemical compound with the molecular formula C5H2ClNO4 and a molecular weight of 175.52 g/mol. IUPAC name: 5-nitrofuran-2-carbonyl chloride. InChIKey: OLEFNFXYGGTROA-UHFFFAOYSA-N.
| Molecular formula | C5H2ClNO4 |
|---|---|
| Molecular weight | 175.52 g/mol |
| IUPAC name | 5-nitrofuran-2-carbonyl chloride |
| InChIKey | OLEFNFXYGGTROA-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)