CAS 2509103-99-3 appears in our catalog under these names: Binimetinib Impurity 6, Ethyl 5-((4-Bromo-2-fluorophenyl)amino)-4-fluoro-1-methyl-1H-benzimidazole-6-carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Ethyl 6-(4-bromo-2-fluoroanilino)-7-fluoro-3-methylbenzimidazole-5-carboxylate (CAS 2509103-99-3) is a chemical compound with the molecular formula C17H14BrF2N3O2 and a molecular weight of 410.2 g/mol. IUPAC name: ethyl 6-(4-bromo-2-fluoroanilino)-7-fluoro-3-methylbenzimidazole-5-carboxylate. InChIKey: OCRPZASHKZCJQT-UHFFFAOYSA-N.
| Molecular formula | C17H14BrF2N3O2 |
|---|---|
| Molecular weight | 410.2 g/mol |
| IUPAC name | ethyl 6-(4-bromo-2-fluoroanilino)-7-fluoro-3-methylbenzimidazole-5-carboxylate |
| InChIKey | OCRPZASHKZCJQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C(=C1NC3=C(C=C(C=C3)Br)F)F)N=CN2C |
Computed by PubChem (NCBI)