Products 2509360-22-7
CAS 2509360-22-7 is the registry number for Thalidomide-O-C3-NH2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-aminopropoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2509360-22-7) is a chemical compound with the molecular formula C16H17N3O5 and a molecular weight of 331.32 g/mol. IUPAC name: 4-(3-aminopropoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: SRDWBGCPVRCTTA-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O5 |
|---|---|
| Molecular weight | 331.32 g/mol |
| IUPAC name | 4-(3-aminopropoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | SRDWBGCPVRCTTA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCN |
Computed by PubChem (NCBI)