Products 2511739-37-8

CAS 2511739-37-8 is the registry number for 3-((5-Carboxypyridin-3-yl)oxy)phthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[(5-carboxy-3-pyridinyl)oxy]phthalic acid (CAS 2511739-37-8) is a chemical compound with the molecular formula C14H9NO7 and a molecular weight of 303.22 g/mol. IUPAC name: 3-[(5-carboxy-3-pyridinyl)oxy]phthalic acid. InChIKey: SRHMAVHLYLZYFW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO7
Molecular weight303.22 g/mol
IUPAC name3-[(5-carboxy-3-pyridinyl)oxy]phthalic acid
InChIKeySRHMAVHLYLZYFW-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)OC2=CN=CC(=C2)C(=O)O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)