Products 2512-56-3
CAS 2512-56-3 appears in our catalog under these names: Salicylic acid 4-octylphenyl ester, 95%, 4-Octylphenyl 2-hydroxybenzoate, 95+%, 4–Octylphenyl 2–hydroxybenzoate, 4-Octylphenyl 2-hydroxybenzoate 95+%, 4-Octylphenyl 2-hydroxybenzoate, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, HPC Standards. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 1x1000mg.
(4-octylphenyl) 2-hydroxybenzoate (CAS 2512-56-3) is a chemical compound with the molecular formula C21H26O3 and a molecular weight of 326.4 g/mol. IUPAC name: (4-octylphenyl) 2-hydroxybenzoate. InChIKey: VNFXPOAMRORRJJ-UHFFFAOYSA-N.
| Molecular formula | C21H26O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (4-octylphenyl) 2-hydroxybenzoate |
| InChIKey | VNFXPOAMRORRJJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)
Synonyms:
4-Octylphenyl Salicylate, 4-octylphenyl 2-hydroxybenzoate, Salicylic Acid 4-Octylphenyl Ester, (4-octylphenyl) 2-hydroxybenzoate, Benzoic acid, 2-hydroxy-, 4-octylphenyl ester, Salicylic acid p-octylphenyl ester, Salicylic acid, p-octylphenyl ester, OHBzo8P, Benzoic acid,2-hydroxy-, 4-octylphenyl ester, PARA-OCTYLPHENYLSALICYLATE