CAS 2512193-15-4 is the registry number for 2,2,4-Trimethyl-1,3-pentanediol-d6. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-methyl-2,2-bis(trideuteriomethyl)pentane-1,3-diol (CAS 2512193-15-4) is a chemical compound with the molecular formula C8H18O2 and a molecular weight of 152.26 g/mol. IUPAC name: 4-methyl-2,2-bis(trideuteriomethyl)pentane-1,3-diol. InChIKey: JCTXKRPTIMZBJT-LIJFRPJRSA-N.
| Molecular formula | C8H18O2 |
|---|---|
| Molecular weight | 152.26 g/mol |
| IUPAC name | 4-methyl-2,2-bis(trideuteriomethyl)pentane-1,3-diol |
| InChIKey | JCTXKRPTIMZBJT-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])C(CO)(C(C(C)C)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)