CAS 2512203-87-9 is the registry number for Bromhexine Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dibromo-3-cyclohexyl-1,2-dihydroquinazolin-4-one (CAS 2512203-87-9) is a chemical compound with the molecular formula C14H16Br2N2O and a molecular weight of 388.10 g/mol. IUPAC name: 6,8-dibromo-3-cyclohexyl-1,2-dihydroquinazolin-4-one. InChIKey: UIKZINGLGKAFLE-UHFFFAOYSA-N.
| Molecular formula | C14H16Br2N2O |
|---|---|
| Molecular weight | 388.10 g/mol |
| IUPAC name | 6,8-dibromo-3-cyclohexyl-1,2-dihydroquinazolin-4-one |
| InChIKey | UIKZINGLGKAFLE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2CNC3=C(C2=O)C=C(C=C3Br)Br |
Computed by PubChem (NCBI)