CAS 2512204-82-7 is the registry number for N-(5-Chloro-2-(4-methoxyphenoxy)-4-nitrophenyl)methanesulfonamide. Offered by: TRC. Available pack sizes: 250mg, 25mg.
N-[5-chloro-2-(4-methoxyphenoxy)-4-nitrophenyl]methanesulfonamide (CAS 2512204-82-7) is a chemical compound with the molecular formula C14H13ClN2O6S and a molecular weight of 372.8 g/mol. IUPAC name: N-[5-chloro-2-(4-methoxyphenoxy)-4-nitrophenyl]methanesulfonamide. InChIKey: OQLHBHUJIDNRDB-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O6S |
|---|---|
| Molecular weight | 372.8 g/mol |
| IUPAC name | N-[5-chloro-2-(4-methoxyphenoxy)-4-nitrophenyl]methanesulfonamide |
| InChIKey | OQLHBHUJIDNRDB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC(=C(C=C2NS(=O)(=O)C)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)