CAS 2512213-47-5 appears in our catalog under these names: Flunitrazepam Impurity 3, 3-Amino-4-(2-fluorophenyl)-1-methyl-6-nitroquinolin-2(1H)-one. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 25mg, 100mg.
3-amino-4-(2-fluorophenyl)-1-methyl-6-nitroquinolin-2-one (CAS 2512213-47-5) is a chemical compound with the molecular formula C16H12FN3O3 and a molecular weight of 313.28 g/mol. IUPAC name: 3-amino-4-(2-fluorophenyl)-1-methyl-6-nitroquinolin-2-one. InChIKey: UOVQULTZRCIIOK-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O3 |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | 3-amino-4-(2-fluorophenyl)-1-methyl-6-nitroquinolin-2-one |
| InChIKey | UOVQULTZRCIIOK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])C(=C(C1=O)N)C3=CC=CC=C3F |
Computed by PubChem (NCBI)