Products 2512216-68-9

CAS 2512216-68-9 is the registry number for Iminostilbene Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide (CAS 2512216-68-9) is a chemical compound with the molecular formula C15H11Br2NO and a molecular weight of 381.06 g/mol. IUPAC name: 5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide. InChIKey: VQWQTCHQHLQUNI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11Br2NO
Molecular weight381.06 g/mol
IUPAC name5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide
InChIKeyVQWQTCHQHLQUNI-UHFFFAOYSA-N
SMILESC1C(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)Br)Br

Computed by PubChem (NCBI)