CAS 2512216-68-9 is the registry number for Iminostilbene Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide (CAS 2512216-68-9) is a chemical compound with the molecular formula C15H11Br2NO and a molecular weight of 381.06 g/mol. IUPAC name: 5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide. InChIKey: VQWQTCHQHLQUNI-UHFFFAOYSA-N.
| Molecular formula | C15H11Br2NO |
|---|---|
| Molecular weight | 381.06 g/mol |
| IUPAC name | 5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide |
| InChIKey | VQWQTCHQHLQUNI-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)Br)Br |
Computed by PubChem (NCBI)