Products 2512217-93-3

CAS 2512217-93-3 is the registry number for 2-(Diethylamino)ethyl 3-Amino-4-methoxybenzoate Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2-(diethylamino)ethyl 3-amino-4-methoxybenzoate;hydrochloride (CAS 2512217-93-3) is a chemical compound with the molecular formula C14H23ClN2O3 and a molecular weight of 302.80 g/mol. IUPAC name: 2-(diethylamino)ethyl 3-amino-4-methoxybenzoate;hydrochloride. InChIKey: LYEXXSVXQRKXET-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23ClN2O3
Molecular weight302.80 g/mol
IUPAC name2-(diethylamino)ethyl 3-amino-4-methoxybenzoate;hydrochloride
InChIKeyLYEXXSVXQRKXET-UHFFFAOYSA-N
SMILESCCN(CC)CCOC(=O)C1=CC(=C(C=C1)OC)N.Cl

Computed by PubChem (NCBI)