CAS 2512227-13-1 appears in our catalog under these names: Mal–PEG4–C2–NH2 TFA, Mal-PEG4-C2-NH2 TFA 98%, 1-(14-Amino-3,6,9,12-tetraoxatetradecyl)-1H-pyrrole-2,5-dione 2,2,2-trifluoroacetate, 98%, 98%, Mal-PEG4-C2-NH2 (TFA), 98.60%, Mal-PEG4-C2-NH2 (TFA), 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 250 mg, 500 mg, 100 mg.
1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (CAS 2512227-13-1) is a chemical compound with the molecular formula C16H25F3N2O8 and a molecular weight of 430.37 g/mol. IUPAC name: 1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid. InChIKey: VZGVXVADGJIXQP-UHFFFAOYSA-N.
| Molecular formula | C16H25F3N2O8 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | 1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| InChIKey | VZGVXVADGJIXQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)