CAS 251295-67-7 is the registry number for Potassium 4-(morpholin-4-ylmethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
Potassium 4-(morpholin-4-ylmethyl)benzoate (CAS 251295-67-7) is a chemical compound with the molecular formula C12H14KNO3 and a molecular weight of 259.34 g/mol. IUPAC name: potassium 4-(morpholin-4-ylmethyl)benzoate. InChIKey: FQUVKQZTGHRNBR-UHFFFAOYSA-M.
| Molecular formula | C12H14KNO3 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | potassium 4-(morpholin-4-ylmethyl)benzoate |
| InChIKey | FQUVKQZTGHRNBR-UHFFFAOYSA-M |
| SMILES | C1COCCN1CC2=CC=C(C=C2)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)