CAS 25130-29-4 appears in our catalog under these names: 5-Chlorocytidine, 95%, 5-Chlorocytidine, 5-Chlorocytidine, >95% (HPLC), 5-Chlorocytidine 97%, 5-Chlorocytidine, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, on request, 50mg, 25mg, 500mg, 1g.
4-amino-5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 25130-29-4) is a chemical compound with the molecular formula C9H12ClN3O5 and a molecular weight of 277.66 g/mol. IUPAC name: 4-amino-5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: LOFVQBRIYOQFDZ-UAKXSSHOSA-N.
| Molecular formula | C9H12ClN3O5 |
|---|---|
| Molecular weight | 277.66 g/mol |
| IUPAC name | 4-amino-5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | LOFVQBRIYOQFDZ-UAKXSSHOSA-N |
| SMILES | C1=C(C(=NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)Cl |
Computed by PubChem (NCBI)