CAS 251310-15-3 is the registry number for 5,6-Dihydrobiopterin. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6-dihydro-3H-pteridin-4-one (CAS 251310-15-3) is a chemical compound with the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. IUPAC name: 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6-dihydro-3H-pteridin-4-one. InChIKey: YGLCGXXAOJQWJS-BYAPIUGTSA-N.
| Molecular formula | C9H13N5O3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6-dihydro-3H-pteridin-4-one |
| InChIKey | YGLCGXXAOJQWJS-BYAPIUGTSA-N |
| SMILES | C[C@@H]([C@@H](C1C=NC2=C(N1)C(=O)NC(=N2)N)O)O |
Computed by PubChem (NCBI)