Products 251320-79-3

CAS 251320-79-3 is the registry number for N-(4'-Ethoxy-(1,1'-biphenyl)-2-yl)-1,1-diphenylmethanimine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[2-(4-ethoxyphenyl)phenyl]-1,1-diphenylmethanimine (CAS 251320-79-3) is a chemical compound with the molecular formula C27H23NO and a molecular weight of 377.5 g/mol. IUPAC name: N-[2-(4-ethoxyphenyl)phenyl]-1,1-diphenylmethanimine. InChIKey: VYTCOEDNBXSFFW-UHFFFAOYSA-N.

Identity
Molecular formulaC27H23NO
Molecular weight377.5 g/mol
IUPAC nameN-[2-(4-ethoxyphenyl)phenyl]-1,1-diphenylmethanimine
InChIKeyVYTCOEDNBXSFFW-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)C2=CC=CC=C2N=C(C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)