Products 25140-95-8
CAS 25140-95-8 appears in our catalog under these names: 2-(3-Methylphenoxy)propanoic acid, 95%, 2-(3-METHYLPHENOXY)PROPANOIC ACID, 97%, 97%, 2-(3-methylphenoxy)propanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(3-methylphenoxy)propanoic acid (CAS 25140-95-8) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(3-methylphenoxy)propanoic acid. InChIKey: NVECNFGARHPBLU-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(3-methylphenoxy)propanoic acid |
| InChIKey | NVECNFGARHPBLU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(3-Methylphenoxy)propanoic acid, Propanoic acid, 2-(3-methylphenoxy)-, 2-(m-Tolyloxy)propanoic acid, 2-(m-Tolyloxy)propionic acid, Propionic acid, 2-(m-tolyloxy)-, alpha-(3-Methylphenoxy)propanoic acid, .alpha.-(3-Methylphenoxy)propanoic acid, 2-(3-Methylphenoxy)propionic acid, Propanoic acid,2-(3-methylphenoxy)-, Enamine_005647