CAS 2514608-03-6 is the registry number for tert-Butyl (S)-(4,4-difluoro-1-hydroxybutan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-4,4-difluoro-1-hydroxybutan-2-yl]carbamate (CAS 2514608-03-6) is a chemical compound with the molecular formula C9H17F2NO3 and a molecular weight of 225.23 g/mol. IUPAC name: tert-butyl N-[(2S)-4,4-difluoro-1-hydroxybutan-2-yl]carbamate. InChIKey: FIGRNQDEWAYPRM-LURJTMIESA-N.
| Molecular formula | C9H17F2NO3 |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4,4-difluoro-1-hydroxybutan-2-yl]carbamate |
| InChIKey | FIGRNQDEWAYPRM-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(F)F)CO |
Computed by PubChem (NCBI)