CAS 2514681-28-6 is the registry number for (S)-α-Acetolactic acid potassium. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
Potassium (2S)-2-hydroxy-2-methyl-3-oxobutanoate (CAS 2514681-28-6) is a chemical compound with the molecular formula C5H7KO4 and a molecular weight of 170.20 g/mol. IUPAC name: potassium (2S)-2-hydroxy-2-methyl-3-oxobutanoate. InChIKey: VARFGJAMZFXOOB-JEDNCBNOSA-M.
| Molecular formula | C5H7KO4 |
|---|---|
| Molecular weight | 170.20 g/mol |
| IUPAC name | potassium (2S)-2-hydroxy-2-methyl-3-oxobutanoate |
| InChIKey | VARFGJAMZFXOOB-JEDNCBNOSA-M |
| SMILES | CC(=O)[C@@](C)(C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)