CAS 2514681-42-4 is the registry number for 4,5-Diamino-2-chlorobenzonitrile Dihydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
4,5-diamino-2-chlorobenzonitrile;dihydrochloride (CAS 2514681-42-4) is a chemical compound with the molecular formula C7H8Cl3N3 and a molecular weight of 240.5 g/mol. IUPAC name: 4,5-diamino-2-chlorobenzonitrile;dihydrochloride. InChIKey: YXVDDQKRXYJRAV-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3N3 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 4,5-diamino-2-chlorobenzonitrile;dihydrochloride |
| InChIKey | YXVDDQKRXYJRAV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)N)Cl)C#N.Cl.Cl |
Computed by PubChem (NCBI)