CAS 76635-15-9 appears in our catalog under these names: N-(3,5-Dichlorophenyl)guanidine hydrochloride, 95%, N-(3,5-Dichlorophenyl)guanidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(3,5-dichlorophenyl)guanidine;hydrochloride (CAS 76635-15-9) is a chemical compound with the molecular formula C7H8Cl3N3 and a molecular weight of 240.5 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)guanidine;hydrochloride. InChIKey: CDUGKKLLSUKNHI-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3N3 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)guanidine;hydrochloride |
| InChIKey | CDUGKKLLSUKNHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)N=C(N)N.Cl |
Computed by PubChem (NCBI)